About (Z)-2-hydroxyoct-2-enoic acid
(Z)-2-hydroxyoct-2-enoic acid (PubChem CID 87585119) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is (Z)-2-hydroxyoct-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-2-hydroxyoct-2-enoic acid |
| PubChem CID | 87585119 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (Z)-2-hydroxyoct-2-enoic acid |
| SMILES | CCCCC/C=C(\O)C(=O)O |
| InChI | InChI=1S/C8H14O3/c1-2-3-4-5-6-7(9)8(10)11/h6,9H,2-5H2,1H3,(H,10,11)/b7-6- |
| InChIKey | VUGCRZWLUQYEPR-SREVYHEPSA-N |
| XLogP | 2.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-hydroxyoct-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-hydroxyoct-2-enoic acid?
The IUPAC name of (Z)-2-hydroxyoct-2-enoic acid (CID 87585119) is (Z)-2-hydroxyoct-2-enoic acid.
What is the SMILES notation for (Z)-2-hydroxyoct-2-enoic acid?
The canonical SMILES for (Z)-2-hydroxyoct-2-enoic acid is CCCCC/C=C(\O)C(=O)O.
What is the InChIKey of (Z)-2-hydroxyoct-2-enoic acid?
The InChIKey is VUGCRZWLUQYEPR-SREVYHEPSA-N. The full InChI is InChI=1S/C8H14O3/c1-2-3-4-5-6-7(9)8(10)11/h6,9H,2-5H2,1H3,(H,10,11)/b7-6-.
What are the key properties of (Z)-2-hydroxyoct-2-enoic acid?
(Z)-2-hydroxyoct-2-enoic acid has a molecular weight of 158.20 g/mol, XLogP of 2.09, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-hydroxyoct-2-enoic acid is sourced from PubChem (CID 87585119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).