About 2-hexylidenepropanedioic acid
2-hexylidenepropanedioic acid (PubChem CID 21274064) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-hexylidenepropanedioic acid.
Molecular Properties
| Compound Name | 2-hexylidenepropanedioic acid |
| PubChem CID | 21274064 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2-hexylidenepropanedioic acid |
| SMILES | CCCCCC=C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14O4/c1-2-3-4-5-6-7(8(10)11)9(12)13/h6H,2-5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | PCRVPORWZKGZGF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-hexylidenepropanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexylidenepropanedioic acid?
The IUPAC name of 2-hexylidenepropanedioic acid (CID 21274064) is 2-hexylidenepropanedioic acid.
What is the SMILES notation for 2-hexylidenepropanedioic acid?
The canonical SMILES for 2-hexylidenepropanedioic acid is CCCCCC=C(C(=O)O)C(=O)O.
What is the InChIKey of 2-hexylidenepropanedioic acid?
The InChIKey is PCRVPORWZKGZGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-2-3-4-5-6-7(8(10)11)9(12)13/h6H,2-5H2,1H3,(H,10,11)(H,12,13).
What are the key properties of 2-hexylidenepropanedioic acid?
2-hexylidenepropanedioic acid has a molecular weight of 186.21 g/mol, XLogP of 1.66, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexylidenepropanedioic acid is sourced from PubChem (CID 21274064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).