About CID 169059230
CID 169059230 (PubChem CID 169059230) has the molecular formula C4H5Cl2
and a molecular weight of 123.99 g/mol.
Molecular Properties
| Compound Name | CID 169059230 |
| PubChem CID | 169059230 |
| Molecular Formula | C4H5Cl2 |
| Molecular Weight | 123.99 g/mol |
| Exact Mass | 122.98 |
| IUPAC Name | — |
| SMILES | [CH2]CC=C(Cl)Cl |
| InChI | InChI=1S/C4H5Cl2/c1-2-3-4(5)6/h3H,1-2H2 |
| InChIKey | LJRCXWUUTIJSKJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.99 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 169059230 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169059230?
The IUPAC name of CID 169059230 (CID 169059230) is not available.
What is the SMILES notation for CID 169059230?
The canonical SMILES for CID 169059230 is [CH2]CC=C(Cl)Cl.
What is the InChIKey of CID 169059230?
The InChIKey is LJRCXWUUTIJSKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5Cl2/c1-2-3-4(5)6/h3H,1-2H2.
What are the key properties of CID 169059230?
CID 169059230 has a molecular weight of 123.99 g/mol, XLogP of 2.53, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169059230 is sourced from PubChem (CID 169059230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).