C4H5Cl3 — CID 10866623
1,1,4-trichlorobut-1-ene (PubChem CID 10866623) has the molecular formula C4H5Cl3 and a molecular weight of 159.44 g/mol. Its IUPAC name is 1,1,4-trichlorobut-1-ene.
| Compound Name | 1,1,4-trichlorobut-1-ene |
|---|---|
| PubChem CID | 10866623 |
| Molecular Formula | C4H5Cl3 |
| Molecular Weight | 159.44 g/mol |
| Exact Mass | 157.95 |
| IUPAC Name | 1,1,4-trichlorobut-1-ene |
| SMILES | ClCCC=C(Cl)Cl |
| InChI | InChI=1S/C4H5Cl3/c5-3-1-2-4(6)7/h2H,1,3H2 |
| InChIKey | CVLVVCWCZJRIHC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|