C7H13Cl2N3 — CID 164646242
2-(3,3-dichloroprop-2-enyl)-1-propan-2-ylguanidine (PubChem CID 164646242) has the molecular formula C7H13Cl2N3 and a molecular weight of 210.11 g/mol. Its IUPAC name is 2-(3,3-dichloroprop-2-enyl)-1-propan-2-ylguanidine.
| Compound Name | 2-(3,3-dichloroprop-2-enyl)-1-propan-2-ylguanidine |
|---|---|
| PubChem CID | 164646242 |
| Molecular Formula | C7H13Cl2N3 |
| Molecular Weight | 210.11 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-(3,3-dichloroprop-2-enyl)-1-propan-2-ylguanidine |
| SMILES | CC(C)N/C(N)=N/CC=C(Cl)Cl |
| InChI | InChI=1S/C7H13Cl2N3/c1-5(2)12-7(10)11-4-3-6(8)9/h3,5H,4H2,1-2H3,(H3,10,11,12) |
| InChIKey | FWSNGISQTJXOPM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.11 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|