C11H25N3O — CID 107153084
2-(2-hydroxy-4,4-dimethylpentyl)-1-propan-2-ylguanidine (PubChem CID 107153084) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-(2-hydroxy-4,4-dimethylpentyl)-1-propan-2-ylguanidine.
| Compound Name | 2-(2-hydroxy-4,4-dimethylpentyl)-1-propan-2-ylguanidine |
|---|---|
| PubChem CID | 107153084 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 2-(2-hydroxy-4,4-dimethylpentyl)-1-propan-2-ylguanidine |
| SMILES | CC(C)N/C(N)=N/CC(O)CC(C)(C)C |
| InChI | InChI=1S/C11H25N3O/c1-8(2)14-10(12)13-7-9(15)6-11(3,4)5/h8-9,15H,6-7H2,1-5H3,(H3,12,13,14) |
| InChIKey | AQKIELSHMWZSKT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|