C20H23Cl2N3O2 — CID 13216276
N-(4-amino-5-chloro-2-methoxyphenyl)-1-[(3-chlorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 13216276) has the molecular formula C20H23Cl2N3O2 and a molecular weight of 408.33 g/mol. Its IUPAC name is N-(4-amino-5-chloro-2-methoxyphenyl)-1-[(3-chlorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-(4-amino-5-chloro-2-methoxyphenyl)-1-[(3-chlorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 13216276 |
| Molecular Formula | C20H23Cl2N3O2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-(4-amino-5-chloro-2-methoxyphenyl)-1-[(3-chlorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | COc1cc(N)c(Cl)cc1NC(=O)C1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H23Cl2N3O2/c1-27-19-11-17(23)16(22)10-18(19)24-20(26)14-5-7-25(8-6-14)12-13-3-2-4-15(21)9-13/h2-4,9-11,14H,5-8,12,23H2,1H3,(H,24,26) |
| InChIKey | OKFMHSRKLYWYSH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|