C23H27ClN2O3 — CID 46774567
ethyl 4-[[1-[(3-chlorophenyl)methyl]piperidine-4-carbonyl]amino]-3-methylbenzoate (PubChem CID 46774567) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is ethyl 4-[[1-[(3-chlorophenyl)methyl]piperidine-4-carbonyl]amino]-3-methylbenzoate.
| Compound Name | ethyl 4-[[1-[(3-chlorophenyl)methyl]piperidine-4-carbonyl]amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 46774567 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | ethyl 4-[[1-[(3-chlorophenyl)methyl]piperidine-4-carbonyl]amino]-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CCN(Cc3cccc(Cl)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C23H27ClN2O3/c1-3-29-23(28)19-7-8-21(16(2)13-19)25-22(27)18-9-11-26(12-10-18)15-17-5-4-6-20(24)14-17/h4-8,13-14,18H,3,9-12,15H2,1-2H3,(H,25,27) |
| InChIKey | QSNZCVLLKCAWAB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |