C18H29N3O2S — CID 13217518
N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]-2-(dimethylamino)-N-methylethanesulfonamide (PubChem CID 13217518) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]-2-(dimethylamino)-N-methylethanesulfonamide.
| Compound Name | N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]-2-(dimethylamino)-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 13217518 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]-2-(dimethylamino)-N-methylethanesulfonamide |
| SMILES | CN(C)CCS(=O)(=O)N(C)[C@@H]1CCN2CCc3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C18H29N3O2S/c1-19(2)12-13-24(22,23)20(3)16-9-11-21-10-8-15-6-4-5-7-17(15)18(21)14-16/h4-7,16,18H,8-14H2,1-3H3/t16-,18+/m1/s1 |
| InChIKey | NVMIAKQTPDAIMA-AEFFLSMTSA-N |
| XLogP | 1.57 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |