About 2-(1-chloroethyl)oxolane
2-(1-chloroethyl)oxolane (PubChem CID 13220757) has the molecular formula C6H11ClO
and a molecular weight of 134.61 g/mol. Its IUPAC name is 2-(1-chloroethyl)oxolane.
Molecular Properties
| Compound Name | 2-(1-chloroethyl)oxolane |
| PubChem CID | 13220757 |
| Molecular Formula | C6H11ClO |
| Molecular Weight | 134.61 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 2-(1-chloroethyl)oxolane |
| SMILES | CC(Cl)C1CCCO1 |
| InChI | InChI=1S/C6H11ClO/c1-5(7)6-3-2-4-8-6/h5-6H,2-4H2,1H3 |
| InChIKey | GWAALTYEOBRBEO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.61 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-chloroethyl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloroethyl)oxolane?
The IUPAC name of 2-(1-chloroethyl)oxolane (CID 13220757) is 2-(1-chloroethyl)oxolane.
What is the SMILES notation for 2-(1-chloroethyl)oxolane?
The canonical SMILES for 2-(1-chloroethyl)oxolane is CC(Cl)C1CCCO1.
What is the InChIKey of 2-(1-chloroethyl)oxolane?
The InChIKey is GWAALTYEOBRBEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClO/c1-5(7)6-3-2-4-8-6/h5-6H,2-4H2,1H3.
What are the key properties of 2-(1-chloroethyl)oxolane?
2-(1-chloroethyl)oxolane has a molecular weight of 134.61 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloroethyl)oxolane is sourced from PubChem (CID 13220757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).