C18H12ClFN4O — CID 13225512
9-chloro-7-(2-fluorophenyl)-6-oxido-5H-pyrimido[5,4-d][2]benzazepin-6-ium-2-amine (PubChem CID 13225512) has the molecular formula C18H12ClFN4O and a molecular weight of 354.77 g/mol. Its IUPAC name is 9-chloro-7-(2-fluorophenyl)-6-oxido-5H-pyrimido[5,4-d][2]benzazepin-6-ium-2-amine.
| Compound Name | 9-chloro-7-(2-fluorophenyl)-6-oxido-5H-pyrimido[5,4-d][2]benzazepin-6-ium-2-amine |
|---|---|
| PubChem CID | 13225512 |
| Molecular Formula | C18H12ClFN4O |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 9-chloro-7-(2-fluorophenyl)-6-oxido-5H-pyrimido[5,4-d][2]benzazepin-6-ium-2-amine |
| SMILES | Nc1ncc2c(n1)-c1ccc(Cl)cc1C(c1ccccc1F)=[N+]([O-])C2 |
| InChI | InChI=1S/C18H12ClFN4O/c19-11-5-6-12-14(7-11)17(13-3-1-2-4-15(13)20)24(25)9-10-8-22-18(21)23-16(10)12/h1-8H,9H2,(H2,21,22,23) |
| InChIKey | NBDMULRONZEXNZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 77.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|