C14H20BrClN2O2S — CID 13229215
2-(diethylamino)ethyl (1Z)-2-(4-bromophenyl)-N-hydroxy-2-oxoethanimidothioate;hydrochloride (PubChem CID 13229215) has the molecular formula C14H20BrClN2O2S and a molecular weight of 395.75 g/mol. Its IUPAC name is 2-(diethylamino)ethyl (1Z)-2-(4-bromophenyl)-N-hydroxy-2-oxoethanimidothioate;hydrochloride.
| Compound Name | 2-(diethylamino)ethyl (1Z)-2-(4-bromophenyl)-N-hydroxy-2-oxoethanimidothioate;hydrochloride |
|---|---|
| PubChem CID | 13229215 |
| Molecular Formula | C14H20BrClN2O2S |
| Molecular Weight | 395.75 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 2-(diethylamino)ethyl (1Z)-2-(4-bromophenyl)-N-hydroxy-2-oxoethanimidothioate;hydrochloride |
| SMILES | CCN(CC)CCS/C(=N\O)C(=O)c1ccc(Br)cc1.Cl |
| InChI | InChI=1S/C14H19BrN2O2S.ClH/c1-3-17(4-2)9-10-20-14(16-19)13(18)11-5-7-12(15)8-6-11;/h5-8,19H,3-4,9-10H2,1-2H3;1H/b16-14-; |
| InChIKey | FSTRYCCCSBTXGU-ULQCMBKMSA-N |
| XLogP | 3.92 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.75 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|