C10H6O4S — CID 13230877
4-oxo-5-sulfanylchromene-2-carboxylic acid (PubChem CID 13230877) has the molecular formula C10H6O4S and a molecular weight of 222.22 g/mol. Its IUPAC name is 4-oxo-5-sulfanylchromene-2-carboxylic acid.
| Compound Name | 4-oxo-5-sulfanylchromene-2-carboxylic acid |
|---|---|
| PubChem CID | 13230877 |
| Molecular Formula | C10H6O4S |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 4-oxo-5-sulfanylchromene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)c2c(S)cccc2o1 |
| InChI | InChI=1S/C10H6O4S/c11-5-4-7(10(12)13)14-6-2-1-3-8(15)9(5)6/h1-4,15H,(H,12,13) |
| InChIKey | ORAKFFOAIGGERH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|