C15H29Cl — CID 13231274
(E,3R,7R)-1-chloro-3,7,11-trimethyldodec-4-ene (PubChem CID 13231274) has the molecular formula C15H29Cl and a molecular weight of 244.85 g/mol. Its IUPAC name is (E,3R,7R)-1-chloro-3,7,11-trimethyldodec-4-ene.
| Compound Name | (E,3R,7R)-1-chloro-3,7,11-trimethyldodec-4-ene |
|---|---|
| PubChem CID | 13231274 |
| Molecular Formula | C15H29Cl |
| Molecular Weight | 244.85 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | (E,3R,7R)-1-chloro-3,7,11-trimethyldodec-4-ene |
| SMILES | CC(C)CCC[C@@H](C)C/C=C/[C@H](C)CCCl |
| InChI | InChI=1S/C15H29Cl/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h6,10,13-15H,5,7-9,11-12H2,1-4H3/b10-6+/t14-,15+/m1/s1 |
| InChIKey | IGSFDQADUZISNQ-PHGPQXGHSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.85 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|