C23H26N2OS — CID 1323887
[1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]-pyrrolidin-1-ylmethanethione (PubChem CID 1323887) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is [1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]-pyrrolidin-1-ylmethanethione.
| Compound Name | [1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]-pyrrolidin-1-ylmethanethione |
|---|---|
| PubChem CID | 1323887 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | [1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]-pyrrolidin-1-ylmethanethione |
| SMILES | Cc1ccc(OCCn2cc(C(=S)N3CCCC3)c3ccccc32)cc1C |
| InChI | InChI=1S/C23H26N2OS/c1-17-9-10-19(15-18(17)2)26-14-13-25-16-21(20-7-3-4-8-22(20)25)23(27)24-11-5-6-12-24/h3-4,7-10,15-16H,5-6,11-14H2,1-2H3 |
| InChIKey | OHTQPLXIUBCWHF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|