C18H27N — CID 13240399
8-methyl-11-phenyl-8-azaspiro[5.6]dodecane (PubChem CID 13240399) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 8-methyl-11-phenyl-8-azaspiro[5.6]dodecane.
| Compound Name | 8-methyl-11-phenyl-8-azaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 13240399 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 8-methyl-11-phenyl-8-azaspiro[5.6]dodecane |
| SMILES | CN1CCC(c2ccccc2)CC2(CCCCC2)C1 |
| InChI | InChI=1S/C18H27N/c1-19-13-10-17(16-8-4-2-5-9-16)14-18(15-19)11-6-3-7-12-18/h2,4-5,8-9,17H,3,6-7,10-15H2,1H3 |
| InChIKey | WUGKTAIBGHOKAY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |