C10H15FN4O — CID 132407662
(3R,4R)-1-[6-(dimethylamino)pyrazin-2-yl]-4-fluoropyrrolidin-3-ol (PubChem CID 132407662) has the molecular formula C10H15FN4O and a molecular weight of 226.25 g/mol. Its IUPAC name is (3R,4R)-1-[6-(dimethylamino)pyrazin-2-yl]-4-fluoropyrrolidin-3-ol.
| Compound Name | (3R,4R)-1-[6-(dimethylamino)pyrazin-2-yl]-4-fluoropyrrolidin-3-ol |
|---|---|
| PubChem CID | 132407662 |
| Molecular Formula | C10H15FN4O |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (3R,4R)-1-[6-(dimethylamino)pyrazin-2-yl]-4-fluoropyrrolidin-3-ol |
| SMILES | CN(C)C1=NC(=CN=C1)N2C[C@H]([C@@H](C2)F)O |
| InChI | InChI=1S/C10H15FN4O/c1-14(2)9-3-12-4-10(13-9)15-5-7(11)8(16)6-15/h3-4,7-8,16H,5-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | WMXKTUOIBDGGQO-HTQZYQBOSA-N |
| XLogP | 0.30 |
| TPSA | 52.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | 241 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |