C24H22F3N3O3 — CID 1324165
8-[(dimethylamino)methyl]-6-ethyl-7-hydroxy-3-(1-phenylpyrazol-4-yl)-2-(trifluoromethyl)chromen-4-one (PubChem CID 1324165) has the molecular formula C24H22F3N3O3 and a molecular weight of 457.45 g/mol. Its IUPAC name is 8-[(dimethylamino)methyl]-6-ethyl-7-hydroxy-3-(1-phenylpyrazol-4-yl)-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 8-[(dimethylamino)methyl]-6-ethyl-7-hydroxy-3-(1-phenylpyrazol-4-yl)-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 1324165 |
| Molecular Formula | C24H22F3N3O3 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 8-[(dimethylamino)methyl]-6-ethyl-7-hydroxy-3-(1-phenylpyrazol-4-yl)-2-(trifluoromethyl)chromen-4-one |
| SMILES | CCc1cc2c(=O)c(-c3cnn(-c4ccccc4)c3)c(C(F)(F)F)oc2c(CN(C)C)c1O |
| InChI | InChI=1S/C24H22F3N3O3/c1-4-14-10-17-21(32)19(15-11-28-30(12-15)16-8-6-5-7-9-16)23(24(25,26)27)33-22(17)18(20(14)31)13-29(2)3/h5-12,31H,4,13H2,1-3H3 |
| InChIKey | IDOCQZWNPSZARR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|