C19H18N2O3 — CID 886358
1-(5-ethyl-2,4-dihydroxyphenyl)-2-(1-phenylpyrazol-4-yl)ethanone (PubChem CID 886358) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 1-(5-ethyl-2,4-dihydroxyphenyl)-2-(1-phenylpyrazol-4-yl)ethanone.
| Compound Name | 1-(5-ethyl-2,4-dihydroxyphenyl)-2-(1-phenylpyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 886358 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 1-(5-ethyl-2,4-dihydroxyphenyl)-2-(1-phenylpyrazol-4-yl)ethanone |
| SMILES | CCc1cc(C(=O)Cc2cnn(-c3ccccc3)c2)c(O)cc1O |
| InChI | InChI=1S/C19H18N2O3/c1-2-14-9-16(19(24)10-17(14)22)18(23)8-13-11-20-21(12-13)15-6-4-3-5-7-15/h3-7,9-12,22,24H,2,8H2,1H3 |
| InChIKey | YVZVNJQAUQJLRU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |