C17H14N2O4 — CID 805519
2-(1-phenylpyrazol-4-yl)-1-(2,3,4-trihydroxyphenyl)ethanone (PubChem CID 805519) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-(1-phenylpyrazol-4-yl)-1-(2,3,4-trihydroxyphenyl)ethanone.
| Compound Name | 2-(1-phenylpyrazol-4-yl)-1-(2,3,4-trihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 805519 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-(1-phenylpyrazol-4-yl)-1-(2,3,4-trihydroxyphenyl)ethanone |
| SMILES | O=C(Cc1cnn(-c2ccccc2)c1)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C17H14N2O4/c20-14-7-6-13(16(22)17(14)23)15(21)8-11-9-18-19(10-11)12-4-2-1-3-5-12/h1-7,9-10,20,22-23H,8H2 |
| InChIKey | DUNQZZMQXKCENE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|