C20H22N4O2 — CID 13243491
5-[4-(4-aminobenzoyl)piperazin-1-yl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 13243491) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 5-[4-(4-aminobenzoyl)piperazin-1-yl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 5-[4-(4-aminobenzoyl)piperazin-1-yl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 13243491 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 5-[4-(4-aminobenzoyl)piperazin-1-yl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Nc1ccc(C(=O)N2CCN(c3cccc4c3CCC(=O)N4)CC2)cc1 |
| InChI | InChI=1S/C20H22N4O2/c21-15-6-4-14(5-7-15)20(26)24-12-10-23(11-13-24)18-3-1-2-17-16(18)8-9-19(25)22-17/h1-7H,8-13,21H2,(H,22,25) |
| InChIKey | UWEDHQOWAIDOQQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|