C18H31NO — CID 132459359
3-cyclopentyl-N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide (PubChem CID 132459359) has the molecular formula C18H31NO and a molecular weight of 277.40 g/mol. Its IUPAC name is 3-cyclopentyl-N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide.
| Compound Name | 3-cyclopentyl-N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide |
|---|---|
| PubChem CID | 132459359 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 3-cyclopentyl-N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide |
| SMILES | CC(=CCC/C(=C/CNC(=O)CCC1CCCC1)/C)C |
| InChI | InChI=1S/C18H31NO/c1-15(2)7-6-8-16(3)13-14-19-18(20)12-11-17-9-4-5-10-17/h7,13,17H,4-6,8-12,14H2,1-3H3,(H,19,20)/b16-13+ |
| InChIKey | AGORZVNYXGBHGV-DTQAZKPQSA-N |
| XLogP | 5.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | 344 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|