C21H17N5O3 — CID 1324594
2-methyl-N-[2-(4-methylphenyl)benzotriazol-5-yl]-3-nitrobenzamide (PubChem CID 1324594) has the molecular formula C21H17N5O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is 2-methyl-N-[2-(4-methylphenyl)benzotriazol-5-yl]-3-nitrobenzamide.
| Compound Name | 2-methyl-N-[2-(4-methylphenyl)benzotriazol-5-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 1324594 |
| Molecular Formula | C21H17N5O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-methyl-N-[2-(4-methylphenyl)benzotriazol-5-yl]-3-nitrobenzamide |
| SMILES | Cc1ccc(-n2nc3ccc(NC(=O)c4cccc([N+](=O)[O-])c4C)cc3n2)cc1 |
| InChI | InChI=1S/C21H17N5O3/c1-13-6-9-16(10-7-13)25-23-18-11-8-15(12-19(18)24-25)22-21(27)17-4-3-5-20(14(17)2)26(28)29/h3-12H,1-2H3,(H,22,27) |
| InChIKey | BVBVGNZIFWIPFZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|