C14H10N4O3S — CID 9204567
N-(2-methyl-3-nitrophenyl)-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 9204567) has the molecular formula C14H10N4O3S and a molecular weight of 314.33 g/mol. Its IUPAC name is N-(2-methyl-3-nitrophenyl)-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-(2-methyl-3-nitrophenyl)-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 9204567 |
| Molecular Formula | C14H10N4O3S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | N-(2-methyl-3-nitrophenyl)-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | Cc1c(NC(=O)c2ccc3nsnc3c2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10N4O3S/c1-8-10(3-2-4-13(8)18(20)21)15-14(19)9-5-6-11-12(7-9)17-22-16-11/h2-7H,1H3,(H,15,19) |
| InChIKey | ICLKJVFZQLJNRA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|