C8H10N4O4 — CID 13247053
methyl 7-nitro-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylate (PubChem CID 13247053) has the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. Its IUPAC name is methyl 7-nitro-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylate.
| Compound Name | methyl 7-nitro-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 13247053 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | methyl 7-nitro-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cn2c(n1)CN([N+](=O)[O-])CC2 |
| InChI | InChI=1S/C8H10N4O4/c1-16-8(13)6-4-10-2-3-11(12(14)15)5-7(10)9-6/h4H,2-3,5H2,1H3 |
| InChIKey | ZCWLZBSACMGHOP-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|