C17H19F3O — CID 132502978
4-(4-tert-butylphenyl)-2-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol (PubChem CID 132502978) has the molecular formula C17H19F3O and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-2-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol.
| Compound Name | 4-(4-tert-butylphenyl)-2-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
|---|---|
| PubChem CID | 132502978 |
| Molecular Formula | C17H19F3O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-(4-tert-butylphenyl)-2-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
| SMILES | CC(C)(C)c1ccc(C#CC(O)(C2CC2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3O/c1-15(2,3)13-6-4-12(5-7-13)10-11-16(21,14-8-9-14)17(18,19)20/h4-7,14,21H,8-9H2,1-3H3 |
| InChIKey | ALAGENFYULJMNC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|