C29H16F6N2 — CID 132503187
2,3-bis[4-(trifluoromethyl)phenyl]phenanthro[9,10-d]imidazole (PubChem CID 132503187) has the molecular formula C29H16F6N2 and a molecular weight of 506.45 g/mol. Its IUPAC name is 2,3-bis[4-(trifluoromethyl)phenyl]phenanthro[9,10-d]imidazole.
| Compound Name | 2,3-bis[4-(trifluoromethyl)phenyl]phenanthro[9,10-d]imidazole |
|---|---|
| PubChem CID | 132503187 |
| Molecular Formula | C29H16F6N2 |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 2,3-bis[4-(trifluoromethyl)phenyl]phenanthro[9,10-d]imidazole |
| SMILES | FC(F)(F)c1ccc(-c2nc3c4ccccc4c4ccccc4c3n2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H16F6N2/c30-28(31,32)18-11-9-17(10-12-18)27-36-25-23-7-3-1-5-21(23)22-6-2-4-8-24(22)26(25)37(27)20-15-13-19(14-16-20)29(33,34)35/h1-16H |
| InChIKey | SKBAHNMJOCAWDR-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|