C46H35N5 — CID 164517930
3-(4-tert-butylphenyl)-6,9-dipyridin-4-yl-2-(4-pyridin-4-ylphenyl)phenanthro[9,10-d]imidazole (PubChem CID 164517930) has the molecular formula C46H35N5 and a molecular weight of 657.82 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-6,9-dipyridin-4-yl-2-(4-pyridin-4-ylphenyl)phenanthro[9,10-d]imidazole.
| Compound Name | 3-(4-tert-butylphenyl)-6,9-dipyridin-4-yl-2-(4-pyridin-4-ylphenyl)phenanthro[9,10-d]imidazole |
|---|---|
| PubChem CID | 164517930 |
| Molecular Formula | C46H35N5 |
| Molecular Weight | 657.82 g/mol |
| Exact Mass | 657.29 |
| IUPAC Name | 3-(4-tert-butylphenyl)-6,9-dipyridin-4-yl-2-(4-pyridin-4-ylphenyl)phenanthro[9,10-d]imidazole |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3ccc(-c4ccncc4)cc3)nc3c4ccc(-c5ccncc5)cc4c4cc(-c5ccncc5)ccc4c32)cc1 |
| InChI | InChI=1S/C46H35N5/c1-46(2,3)37-10-12-38(13-11-37)51-44-40-15-9-36(33-20-26-49-27-21-33)29-42(40)41-28-35(32-18-24-48-25-19-32)8-14-39(41)43(44)50-45(51)34-6-4-30(5-7-34)31-16-22-47-23-17-31/h4-29H,1-3H3 |
| InChIKey | HHQNQIATGKWFST-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.82 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|