C39H34N4 — CID 102529074
2-[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]-3-(3,5-dimethylphenyl)imidazo[4,5-f][1,10]phenanthroline (PubChem CID 102529074) has the molecular formula C39H34N4 and a molecular weight of 558.73 g/mol. Its IUPAC name is 2-[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]-3-(3,5-dimethylphenyl)imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]-3-(3,5-dimethylphenyl)imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 102529074 |
| Molecular Formula | C39H34N4 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 2-[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]-3-(3,5-dimethylphenyl)imidazo[4,5-f][1,10]phenanthroline |
| SMILES | Cc1cc(C)cc(-n2c(-c3ccc(/C=C/c4ccc(C(C)(C)C)cc4)cc3)nc3c4cccnc4c4ncccc4c32)c1 |
| InChI | InChI=1S/C39H34N4/c1-25-22-26(2)24-31(23-25)43-37-33-9-7-21-41-35(33)34-32(8-6-20-40-34)36(37)42-38(43)29-16-12-27(13-17-29)10-11-28-14-18-30(19-15-28)39(3,4)5/h6-24H,1-5H3/b11-10+ |
| InChIKey | MLWSGMVODGDPEV-ZHACJKMWSA-N |
| XLogP | 9.87 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|