C16H16N4O4S — CID 132503439
5-(4-methoxybenzoyl)-1,3-dimethyl-7-sulfanylidene-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 132503439) has the molecular formula C16H16N4O4S and a molecular weight of 360.40 g/mol. Its IUPAC name is 5-(4-methoxybenzoyl)-1,3-dimethyl-7-sulfanylidene-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 5-(4-methoxybenzoyl)-1,3-dimethyl-7-sulfanylidene-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 132503439 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 5-(4-methoxybenzoyl)-1,3-dimethyl-7-sulfanylidene-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(=O)C2NC(=S)Nc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C16H16N4O4S/c1-19-13-10(14(22)20(2)16(19)23)11(17-15(25)18-13)12(21)8-4-6-9(24-3)7-5-8/h4-7,11H,1-3H3,(H2,17,18,25) |
| InChIKey | DWEHOFANGZKETI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|