C22H18N4O3 — CID 92981687
(9S)-9-benzoyl-4,6-dimethyl-2,4,6,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-5,7-dione (PubChem CID 92981687) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is (9S)-9-benzoyl-4,6-dimethyl-2,4,6,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-5,7-dione.
| Compound Name | (9S)-9-benzoyl-4,6-dimethyl-2,4,6,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-5,7-dione |
|---|---|
| PubChem CID | 92981687 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (9S)-9-benzoyl-4,6-dimethyl-2,4,6,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-5,7-dione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)[C@@H](C(=O)c1ccccc1)c1c([nH]c3ccccc13)N2 |
| InChI | InChI=1S/C22H18N4O3/c1-25-20-17(21(28)26(2)22(25)29)16(18(27)12-8-4-3-5-9-12)15-13-10-6-7-11-14(13)23-19(15)24-20/h3-11,16,23-24H,1-2H3/t16-/m0/s1 |
| InChIKey | HMERCHDWYHTLPZ-INIZCTEOSA-N |
| XLogP | 2.64 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |