C28H38N4 — CID 132504336
4-N,4-N',5-N,5-N'-tetra(propan-2-yl)phenanthrene-4,5-dicarboximidamide (PubChem CID 132504336) has the molecular formula C28H38N4 and a molecular weight of 430.64 g/mol. Its IUPAC name is 4-N,4-N',5-N,5-N'-tetra(propan-2-yl)phenanthrene-4,5-dicarboximidamide.
| Compound Name | 4-N,4-N',5-N,5-N'-tetra(propan-2-yl)phenanthrene-4,5-dicarboximidamide |
|---|---|
| PubChem CID | 132504336 |
| Molecular Formula | C28H38N4 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | 4-N,4-N',5-N,5-N'-tetra(propan-2-yl)phenanthrene-4,5-dicarboximidamide |
| SMILES | CC(C)/N=C(\NC(C)C)c1cccc2ccc3cccc(/C(=N/C(C)C)NC(C)C)c3c12 |
| InChI | InChI=1S/C28H38N4/c1-17(2)29-27(30-18(3)4)23-13-9-11-21-15-16-22-12-10-14-24(26(22)25(21)23)28(31-19(5)6)32-20(7)8/h9-20H,1-8H3,(H,29,30)(H,31,32) |
| InChIKey | GXBSUYUPFIHHQQ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|