C16H19ClO6S — CID 132504863
diethyl (2S,5S)-2-(4-chlorophenyl)-5-hydroxy-1,3-oxathiane-4,4-dicarboxylate (PubChem CID 132504863) has the molecular formula C16H19ClO6S and a molecular weight of 374.84 g/mol. Its IUPAC name is diethyl (2S,5S)-2-(4-chlorophenyl)-5-hydroxy-1,3-oxathiane-4,4-dicarboxylate.
| Compound Name | diethyl (2S,5S)-2-(4-chlorophenyl)-5-hydroxy-1,3-oxathiane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 132504863 |
| Molecular Formula | C16H19ClO6S |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | diethyl (2S,5S)-2-(4-chlorophenyl)-5-hydroxy-1,3-oxathiane-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)S[C@@H](c2ccc(Cl)cc2)OC[C@@H]1O |
| InChI | InChI=1S/C16H19ClO6S/c1-3-21-14(19)16(15(20)22-4-2)12(18)9-23-13(24-16)10-5-7-11(17)8-6-10/h5-8,12-13,18H,3-4,9H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | TVKRKTKEBFNXKU-STQMWFEESA-N |
| XLogP | 2.33 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|