C22H29NO4 — CID 132507924
diethyl 2-(dipropylamino)azulene-1,3-dicarboxylate (PubChem CID 132507924) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is diethyl 2-(dipropylamino)azulene-1,3-dicarboxylate.
| Compound Name | diethyl 2-(dipropylamino)azulene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 132507924 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | diethyl 2-(dipropylamino)azulene-1,3-dicarboxylate |
| SMILES | CCCN(CCC)c1c(C(=O)OCC)c2cccccc-2c1C(=O)OCC |
| InChI | InChI=1S/C22H29NO4/c1-5-14-23(15-6-2)20-18(21(24)26-7-3)16-12-10-9-11-13-17(16)19(20)22(25)27-8-4/h9-13H,5-8,14-15H2,1-4H3 |
| InChIKey | GWXFTFVGATYQNL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |