C18H19NOS — CID 132508296
2-(2-butyl-6-methoxyphenyl)-1,3-benzothiazole (PubChem CID 132508296) has the molecular formula C18H19NOS and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-(2-butyl-6-methoxyphenyl)-1,3-benzothiazole.
| Compound Name | 2-(2-butyl-6-methoxyphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 132508296 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-(2-butyl-6-methoxyphenyl)-1,3-benzothiazole |
| SMILES | CCCCc1cccc(OC)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H19NOS/c1-3-4-8-13-9-7-11-15(20-2)17(13)18-19-14-10-5-6-12-16(14)21-18/h5-7,9-12H,3-4,8H2,1-2H3 |
| InChIKey | LJDVLMWRJQOIOX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |