C15H12FNO2S — CID 6712941
2-(3,4-dimethoxyphenyl)-5-fluoro-1,3-benzothiazole (PubChem CID 6712941) has the molecular formula C15H12FNO2S and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-fluoro-1,3-benzothiazole.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-fluoro-1,3-benzothiazole |
|---|---|
| PubChem CID | 6712941 |
| Molecular Formula | C15H12FNO2S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-fluoro-1,3-benzothiazole |
| SMILES | COc1ccc(-c2nc3cc(F)ccc3s2)cc1OC |
| InChI | InChI=1S/C15H12FNO2S/c1-18-12-5-3-9(7-13(12)19-2)15-17-11-8-10(16)4-6-14(11)20-15/h3-8H,1-2H3 |
| InChIKey | ZRLSVQBGBBYEAZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |