C16H15NOS — CID 132508766
4-benzyl-2-phenylsulfanyl-4,5-dihydro-1,3-oxazole (PubChem CID 132508766) has the molecular formula C16H15NOS and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-benzyl-2-phenylsulfanyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-benzyl-2-phenylsulfanyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 132508766 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-benzyl-2-phenylsulfanyl-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc(CC2COC(Sc3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C16H15NOS/c1-3-7-13(8-4-1)11-14-12-18-16(17-14)19-15-9-5-2-6-10-15/h1-10,14H,11-12H2 |
| InChIKey | IVXDULYZNVMWDQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |