C10H10LiNOS — CID 42616064
lithium (4R)-4-benzyl-4,5-dihydro-1,3-oxazole-2-thiolate (PubChem CID 42616064) has the molecular formula C10H10LiNOS and a molecular weight of 199.20 g/mol. Its IUPAC name is lithium (4R)-4-benzyl-4,5-dihydro-1,3-oxazole-2-thiolate.
| Compound Name | lithium (4R)-4-benzyl-4,5-dihydro-1,3-oxazole-2-thiolate |
|---|---|
| PubChem CID | 42616064 |
| Molecular Formula | C10H10LiNOS |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | lithium (4R)-4-benzyl-4,5-dihydro-1,3-oxazole-2-thiolate |
| SMILES | [Li+].[S-]C1=N[C@H](Cc2ccccc2)CO1 |
| InChI | InChI=1S/C10H11NOS.Li/c13-10-11-9(7-12-10)6-8-4-2-1-3-5-8;/h1-5,9H,6-7H2,(H,11,13);/q;+1/p-1/t9-;/m1./s1 |
| InChIKey | VJCCGHRYZIQOKV-SBSPUUFOSA-M |
| XLogP | -1.47 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|