C11H13NO — CID 4692621
4-benzyl-2-methyl-4,5-dihydro-1,3-oxazole (PubChem CID 4692621) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-benzyl-2-methyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-benzyl-2-methyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 4692621 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 4-benzyl-2-methyl-4,5-dihydro-1,3-oxazole |
| SMILES | CC1=NC(Cc2ccccc2)CO1 |
| InChI | InChI=1S/C11H13NO/c1-9-12-11(8-13-9)7-10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3 |
| InChIKey | XFGDWXDHKJEUEA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |