C28H27NO — CID 132509890
(1R,6R,8S)-3-trityl-11-oxa-3-azatricyclo[6.2.1.01,6]undec-9-ene (PubChem CID 132509890) has the molecular formula C28H27NO and a molecular weight of 393.53 g/mol. Its IUPAC name is (1R,6R,8S)-3-trityl-11-oxa-3-azatricyclo[6.2.1.01,6]undec-9-ene.
| Compound Name | (1R,6R,8S)-3-trityl-11-oxa-3-azatricyclo[6.2.1.01,6]undec-9-ene |
|---|---|
| PubChem CID | 132509890 |
| Molecular Formula | C28H27NO |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (1R,6R,8S)-3-trityl-11-oxa-3-azatricyclo[6.2.1.01,6]undec-9-ene |
| SMILES | C1=C[C@@]23CN(C(c4ccccc4)(c4ccccc4)c4ccccc4)CC[C@@H]2C[C@@H]1O3 |
| InChI | InChI=1S/C28H27NO/c1-4-10-22(11-5-1)28(23-12-6-2-7-13-23,24-14-8-3-9-15-24)29-19-17-25-20-26-16-18-27(25,21-29)30-26/h1-16,18,25-26H,17,19-21H2/t25-,26-,27-/m1/s1 |
| InChIKey | PGBPEBFWDPJRRC-ZONZVBGPSA-N |
| XLogP | 5.40 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|