C28H26BrNO — CID 132597902
(1R,5R,7S)-5-bromo-7-methyl-3-trityl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene (PubChem CID 132597902) has the molecular formula C28H26BrNO and a molecular weight of 472.43 g/mol. Its IUPAC name is (1R,5R,7S)-5-bromo-7-methyl-3-trityl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene.
| Compound Name | (1R,5R,7S)-5-bromo-7-methyl-3-trityl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene |
|---|---|
| PubChem CID | 132597902 |
| Molecular Formula | C28H26BrNO |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | (1R,5R,7S)-5-bromo-7-methyl-3-trityl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene |
| SMILES | C[C@@]12C=C[C@]3(CN(C(c4ccccc4)(c4ccccc4)c4ccccc4)C[C@]3(Br)C1)O2 |
| InChI | InChI=1S/C28H26BrNO/c1-25-17-18-27(31-25)21-30(20-26(27,29)19-25)28(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-18H,19-21H2,1H3/t25-,26-,27-/m1/s1 |
| InChIKey | OSDXZGKCUXYLBB-ZONZVBGPSA-N |
| XLogP | 5.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|