C12H15IO — CID 132510677
(2S)-2-(iodomethyl)-3,3-dimethyl-2-(3-methylphenyl)oxirane (PubChem CID 132510677) has the molecular formula C12H15IO and a molecular weight of 302.16 g/mol. Its IUPAC name is (2S)-2-(iodomethyl)-3,3-dimethyl-2-(3-methylphenyl)oxirane.
| Compound Name | (2S)-2-(iodomethyl)-3,3-dimethyl-2-(3-methylphenyl)oxirane |
|---|---|
| PubChem CID | 132510677 |
| Molecular Formula | C12H15IO |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | (2S)-2-(iodomethyl)-3,3-dimethyl-2-(3-methylphenyl)oxirane |
| SMILES | Cc1cccc([C@]2(CI)OC2(C)C)c1 |
| InChI | InChI=1S/C12H15IO/c1-9-5-4-6-10(7-9)12(8-13)11(2,3)14-12/h4-7H,8H2,1-3H3/t12-/m0/s1 |
| InChIKey | RYZHJDGFZQCEAF-LBPRGKRZSA-N |
| XLogP | 3.43 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|