About formonitrile;1-iodo-3-methylbenzene
formonitrile;1-iodo-3-methylbenzene (PubChem CID 174826916) has the molecular formula C8H8IN
and a molecular weight of 245.06 g/mol. Its IUPAC name is formonitrile;1-iodo-3-methylbenzene.
Molecular Properties
| Compound Name | formonitrile;1-iodo-3-methylbenzene |
| PubChem CID | 174826916 |
| Molecular Formula | C8H8IN |
| Molecular Weight | 245.06 g/mol |
| Exact Mass | 244.97 |
| IUPAC Name | formonitrile;1-iodo-3-methylbenzene |
| SMILES | C#N.Cc1cccc(I)c1 |
| InChI | InChI=1S/C7H7I.CHN/c1-6-3-2-4-7(8)5-6;1-2/h2-5H,1H3;1H |
| InChIKey | BOLXXTQJUCUKPP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.06 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze formonitrile;1-iodo-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formonitrile;1-iodo-3-methylbenzene?
The IUPAC name of formonitrile;1-iodo-3-methylbenzene (CID 174826916) is formonitrile;1-iodo-3-methylbenzene.
What is the SMILES notation for formonitrile;1-iodo-3-methylbenzene?
The canonical SMILES for formonitrile;1-iodo-3-methylbenzene is C#N.Cc1cccc(I)c1.
What is the InChIKey of formonitrile;1-iodo-3-methylbenzene?
The InChIKey is BOLXXTQJUCUKPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7I.CHN/c1-6-3-2-4-7(8)5-6;1-2/h2-5H,1H3;1H.
What are the key properties of formonitrile;1-iodo-3-methylbenzene?
formonitrile;1-iodo-3-methylbenzene has a molecular weight of 245.06 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for formonitrile;1-iodo-3-methylbenzene is sourced from PubChem (CID 174826916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).