C32H24O4 — CID 132510785
benzyl 2-oxo-4'-(4-phenylphenyl)spiro[1-benzofuran-3,5'-cyclopentene]-1'-carboxylate (PubChem CID 132510785) has the molecular formula C32H24O4 and a molecular weight of 472.54 g/mol. Its IUPAC name is benzyl 2-oxo-4'-(4-phenylphenyl)spiro[1-benzofuran-3,5'-cyclopentene]-1'-carboxylate.
| Compound Name | benzyl 2-oxo-4'-(4-phenylphenyl)spiro[1-benzofuran-3,5'-cyclopentene]-1'-carboxylate |
|---|---|
| PubChem CID | 132510785 |
| Molecular Formula | C32H24O4 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | benzyl 2-oxo-4'-(4-phenylphenyl)spiro[1-benzofuran-3,5'-cyclopentene]-1'-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1=CCC(c2ccc(-c3ccccc3)cc2)C12C(=O)Oc1ccccc12 |
| InChI | InChI=1S/C32H24O4/c33-30(35-21-22-9-3-1-4-10-22)28-20-19-26(32(28)27-13-7-8-14-29(27)36-31(32)34)25-17-15-24(16-18-25)23-11-5-2-6-12-23/h1-18,20,26H,19,21H2 |
| InChIKey | BVQRMMCWBUYOAZ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|