C52H72F2O2S3 — CID 132511034
5,8-difluoro-1,3-bis[4-(2-hexyldecyl)thiophen-2-yl]benzo[f][2]benzothiole-4,9-dione (PubChem CID 132511034) has the molecular formula C52H72F2O2S3 and a molecular weight of 863.34 g/mol. Its IUPAC name is 5,8-difluoro-1,3-bis[4-(2-hexyldecyl)thiophen-2-yl]benzo[f][2]benzothiole-4,9-dione.
| Compound Name | 5,8-difluoro-1,3-bis[4-(2-hexyldecyl)thiophen-2-yl]benzo[f][2]benzothiole-4,9-dione |
|---|---|
| PubChem CID | 132511034 |
| Molecular Formula | C52H72F2O2S3 |
| Molecular Weight | 863.34 g/mol |
| Exact Mass | 862.47 |
| IUPAC Name | 5,8-difluoro-1,3-bis[4-(2-hexyldecyl)thiophen-2-yl]benzo[f][2]benzothiole-4,9-dione |
| SMILES | CCCCCCCCC(CCCCCC)Cc1csc(-c2sc(-c3cc(CC(CCCCCC)CCCCCCCC)cs3)c3c2C(=O)c2c(F)ccc(F)c2C3=O)c1 |
| InChI | InChI=1S/C52H72F2O2S3/c1-5-9-13-17-19-23-27-37(25-21-15-11-7-3)31-39-33-43(57-35-39)51-47-48(50(56)46-42(54)30-29-41(53)45(46)49(47)55)52(59-51)44-34-40(36-58-44)32-38(26-22-16-12-8-4)28-24-20-18-14-10-6-2/h29-30,33-38H,5-28,31-32H2,1-4H3 |
| InChIKey | JIRNAFOIDZNMAN-UHFFFAOYSA-N |
| XLogP | 18.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.34 |
| LogP ≤ 5 | 18.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|