C50H72O2S4 — CID 132933539
5,7-bis[4-(2-butyloctyl)thiophen-2-yl]-2-(2-ethylhexyl)thieno[3,4-f][1]benzothiole-4,8-dione (PubChem CID 132933539) has the molecular formula C50H72O2S4 and a molecular weight of 833.39 g/mol. Its IUPAC name is 5,7-bis[4-(2-butyloctyl)thiophen-2-yl]-2-(2-ethylhexyl)thieno[3,4-f][1]benzothiole-4,8-dione.
| Compound Name | 5,7-bis[4-(2-butyloctyl)thiophen-2-yl]-2-(2-ethylhexyl)thieno[3,4-f][1]benzothiole-4,8-dione |
|---|---|
| PubChem CID | 132933539 |
| Molecular Formula | C50H72O2S4 |
| Molecular Weight | 833.39 g/mol |
| Exact Mass | 832.44 |
| IUPAC Name | 5,7-bis[4-(2-butyloctyl)thiophen-2-yl]-2-(2-ethylhexyl)thieno[3,4-f][1]benzothiole-4,8-dione |
| SMILES | CCCCCCC(CCCC)Cc1csc(-c2sc(-c3cc(CC(CCCC)CCCCCC)cs3)c3c2C(=O)c2cc(CC(CC)CCCC)sc2C3=O)c1 |
| InChI | InChI=1S/C50H72O2S4/c1-7-13-18-20-25-36(23-16-10-4)27-38-30-42(53-33-38)49-44-45(47(52)48-41(46(44)51)32-40(55-48)29-35(12-6)22-15-9-3)50(56-49)43-31-39(34-54-43)28-37(24-17-11-5)26-21-19-14-8-2/h30-37H,7-29H2,1-6H3 |
| InChIKey | OTNWJAQCOWPWLC-UHFFFAOYSA-N |
| XLogP | 17.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.39 |
| LogP ≤ 5 | 17.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|