C16H11F3N2O — CID 132511211
16-(trifluoromethyl)-13-oxa-2,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),5,7,9,11,15,17-heptaene (PubChem CID 132511211) has the molecular formula C16H11F3N2O and a molecular weight of 304.27 g/mol. Its IUPAC name is 16-(trifluoromethyl)-13-oxa-2,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),5,7,9,11,15,17-heptaene.
| Compound Name | 16-(trifluoromethyl)-13-oxa-2,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),5,7,9,11,15,17-heptaene |
|---|---|
| PubChem CID | 132511211 |
| Molecular Formula | C16H11F3N2O |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 16-(trifluoromethyl)-13-oxa-2,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),5,7,9,11,15,17-heptaene |
| SMILES | FC(F)(F)c1ccc2c(c1)Oc1ccccc1C1=NCCN12 |
| InChI | InChI=1S/C16H11F3N2O/c17-16(18,19)10-5-6-12-14(9-10)22-13-4-2-1-3-11(13)15-20-7-8-21(12)15/h1-6,9H,7-8H2 |
| InChIKey | FQKAWVDCVXTMEQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |