C22H21F3N4O2 — CID 42689254
N-prop-2-enyl-4-[2-(trifluoromethyl)benzo[b][1,4]benzoxazepin-6-yl]piperazine-1-carboxamide (PubChem CID 42689254) has the molecular formula C22H21F3N4O2 and a molecular weight of 430.43 g/mol. Its IUPAC name is N-prop-2-enyl-4-[2-(trifluoromethyl)benzo[b][1,4]benzoxazepin-6-yl]piperazine-1-carboxamide.
| Compound Name | N-prop-2-enyl-4-[2-(trifluoromethyl)benzo[b][1,4]benzoxazepin-6-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42689254 |
| Molecular Formula | C22H21F3N4O2 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-prop-2-enyl-4-[2-(trifluoromethyl)benzo[b][1,4]benzoxazepin-6-yl]piperazine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CCN(C2=Nc3ccc(C(F)(F)F)cc3Oc3ccccc32)CC1 |
| InChI | InChI=1S/C22H21F3N4O2/c1-2-9-26-21(30)29-12-10-28(11-13-29)20-16-5-3-4-6-18(16)31-19-14-15(22(23,24)25)7-8-17(19)27-20/h2-8,14H,1,9-13H2,(H,26,30) |
| InChIKey | OPQRLMKGOAURCA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|