C15H17ClF3N3O — CID 113103718
4-[2-chloro-5-(trifluoromethyl)phenyl]-N-prop-2-enylpiperazine-1-carboxamide (PubChem CID 113103718) has the molecular formula C15H17ClF3N3O and a molecular weight of 347.77 g/mol. Its IUPAC name is 4-[2-chloro-5-(trifluoromethyl)phenyl]-N-prop-2-enylpiperazine-1-carboxamide.
| Compound Name | 4-[2-chloro-5-(trifluoromethyl)phenyl]-N-prop-2-enylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 113103718 |
| Molecular Formula | C15H17ClF3N3O |
| Molecular Weight | 347.77 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-[2-chloro-5-(trifluoromethyl)phenyl]-N-prop-2-enylpiperazine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CCN(c2cc(C(F)(F)F)ccc2Cl)CC1 |
| InChI | InChI=1S/C15H17ClF3N3O/c1-2-5-20-14(23)22-8-6-21(7-9-22)13-10-11(15(17,18)19)3-4-12(13)16/h2-4,10H,1,5-9H2,(H,20,23) |
| InChIKey | VCIUJJARHTVKTP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|