C21H15ClF6N2O — CID 130454993
1-[4-[2-chloro-5-(trifluoromethyl)phenyl]piperazin-1-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-yn-1-one (PubChem CID 130454993) has the molecular formula C21H15ClF6N2O and a molecular weight of 460.81 g/mol. Its IUPAC name is 1-[4-[2-chloro-5-(trifluoromethyl)phenyl]piperazin-1-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-yn-1-one.
| Compound Name | 1-[4-[2-chloro-5-(trifluoromethyl)phenyl]piperazin-1-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 130454993 |
| Molecular Formula | C21H15ClF6N2O |
| Molecular Weight | 460.81 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 1-[4-[2-chloro-5-(trifluoromethyl)phenyl]piperazin-1-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-yn-1-one |
| SMILES | O=C(C#Cc1ccc(C(F)(F)F)cc1)N1CCN(c2cc(C(F)(F)F)ccc2Cl)CC1 |
| InChI | InChI=1S/C21H15ClF6N2O/c22-17-7-6-16(21(26,27)28)13-18(17)29-9-11-30(12-10-29)19(31)8-3-14-1-4-15(5-2-14)20(23,24)25/h1-2,4-7,13H,9-12H2 |
| InChIKey | BUFZDBKHMIMWOA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.81 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|